C10H17N — CID 143285714
1-(6-methylcyclohexa-1,3-dien-1-yl)propan-2-amine (PubChem CID 143285714) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-(6-methylcyclohexa-1,3-dien-1-yl)propan-2-amine.
| Compound Name | 1-(6-methylcyclohexa-1,3-dien-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 143285714 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-(6-methylcyclohexa-1,3-dien-1-yl)propan-2-amine |
| SMILES | CC(N)CC1=CC=CCC1C |
| InChI | InChI=1S/C10H17N/c1-8-5-3-4-6-10(8)7-9(2)11/h3-4,6,8-9H,5,7,11H2,1-2H3 |
| InChIKey | SWTQAILBFUSHGB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |