2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid

C10H15NO2 — CID 149153499

IUPAC2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid
SMILESCC1CC=CC=C1CC(N)C(=O)O
InChIInChI=1S/C10H15NO2/c1-7-4-2-3-5-8(7)6-9(11)10(12)13/h2-3,5,7,9H,4,6,11H2,1H3,(H,12,13)
InChIKeyRMODPOXBFVLXME-UHFFFAOYSA-N
MW181.23 g/mol
LogP1.31
Rot. Bonds3

About 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid

2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid (PubChem CID 149153499) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid
PubChem CID149153499
Molecular FormulaC10H15NO2
Molecular Weight181.23 g/mol
Exact Mass181.11
IUPAC Name2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid
SMILESCC1CC=CC=C1CC(N)C(=O)O
InChIInChI=1S/C10H15NO2/c1-7-4-2-3-5-8(7)6-9(11)10(12)13/h2-3,5,7,9H,4,6,11H2,1H3,(H,12,13)
InChIKeyRMODPOXBFVLXME-UHFFFAOYSA-N
XLogP1.31
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.23
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid?
The IUPAC name of 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid (CID 149153499) is 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid is CC1CC=CC=C1CC(N)C(=O)O.
What is the InChIKey of 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid?
The InChIKey is RMODPOXBFVLXME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-7-4-2-3-5-8(7)6-9(11)10(12)13/h2-3,5,7,9H,4,6,11H2,1H3,(H,12,13).
What are the key properties of 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid?
2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid has a molecular weight of 181.23 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(6-methylcyclohexa-1,3-dien-1-yl)propanoic acid is sourced from PubChem (CID 149153499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).