C10H16 — CID 123906774
6-methyl-1-propylcyclohexa-1,3-diene (PubChem CID 123906774) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 6-methyl-1-propylcyclohexa-1,3-diene.
| Compound Name | 6-methyl-1-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123906774 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 6-methyl-1-propylcyclohexa-1,3-diene |
| SMILES | CCCC1=CC=CCC1C |
| InChI | InChI=1S/C10H16/c1-3-6-10-8-5-4-7-9(10)2/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | UBGPDLWCTVGBPC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |