C21H41NO — CID 143122051
4-methylheptane;N-methyl-2-propylcyclohexa-2,4-dien-1-amine;propanal (PubChem CID 143122051) has the molecular formula C21H41NO and a molecular weight of 323.57 g/mol. Its IUPAC name is 4-methylheptane;N-methyl-2-propylcyclohexa-2,4-dien-1-amine;propanal.
| Compound Name | 4-methylheptane;N-methyl-2-propylcyclohexa-2,4-dien-1-amine;propanal |
|---|---|
| PubChem CID | 143122051 |
| Molecular Formula | C21H41NO |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.32 |
| IUPAC Name | 4-methylheptane;N-methyl-2-propylcyclohexa-2,4-dien-1-amine;propanal |
| SMILES | CCC=O.CCCC(C)CCC.CCCC1=CC=CCC1NC |
| InChI | InChI=1S/C10H17N.C8H18.C3H6O/c1-3-6-9-7-4-5-8-10(9)11-2;1-4-6-8(3)7-5-2;1-2-3-4/h4-5,7,10-11H,3,6,8H2,1-2H3;8H,4-7H2,1-3H3;3H,2H2,1H3 |
| InChIKey | BAVZASOEIYJUSX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|