C19H32 — CID 142237256
4-(3,6-dimethylnonyl)-1-methylcyclohepta-1,3,5-triene (PubChem CID 142237256) has the molecular formula C19H32 and a molecular weight of 260.47 g/mol. Its IUPAC name is 4-(3,6-dimethylnonyl)-1-methylcyclohepta-1,3,5-triene.
| Compound Name | 4-(3,6-dimethylnonyl)-1-methylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142237256 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 4-(3,6-dimethylnonyl)-1-methylcyclohepta-1,3,5-triene |
| SMILES | CCCC(C)CCC(C)CCC1=CC=C(C)CC=C1 |
| InChI | InChI=1S/C19H32/c1-5-7-16(2)10-11-18(4)13-15-19-9-6-8-17(3)12-14-19/h6,9,12,14,16,18H,5,7-8,10-11,13,15H2,1-4H3 |
| InChIKey | HRNPSLUGLMUOSY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |