C10H15Br — CID 145346166
4-bromo-1-methylcyclohepta-1,3,5-triene;ethane (PubChem CID 145346166) has the molecular formula C10H15Br and a molecular weight of 215.13 g/mol. Its IUPAC name is 4-bromo-1-methylcyclohepta-1,3,5-triene;ethane.
| Compound Name | 4-bromo-1-methylcyclohepta-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 145346166 |
| Molecular Formula | C10H15Br |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 4-bromo-1-methylcyclohepta-1,3,5-triene;ethane |
| SMILES | CC.CC1=CC=C(Br)C=CC1 |
| InChI | InChI=1S/C8H9Br.C2H6/c1-7-3-2-4-8(9)6-5-7;1-2/h2,4-6H,3H2,1H3;1-2H3 |
| InChIKey | MCKJTNVVJUBVLN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |