C10H14O — CID 153384449
1-(4-methylcyclohepta-1,3,6-trien-1-yl)ethanol (PubChem CID 153384449) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-(4-methylcyclohepta-1,3,6-trien-1-yl)ethanol.
| Compound Name | 1-(4-methylcyclohepta-1,3,6-trien-1-yl)ethanol |
|---|---|
| PubChem CID | 153384449 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 1-(4-methylcyclohepta-1,3,6-trien-1-yl)ethanol |
| SMILES | CC1=CC=C(C(C)O)C=CC1 |
| InChI | InChI=1S/C10H14O/c1-8-4-3-5-10(7-6-8)9(2)11/h3,5-7,9,11H,4H2,1-2H3 |
| InChIKey | UUJAATMXXATIRT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |