C8H12O — CID 101132775
(1R)-1-cyclohexa-1,5-dien-1-ylethanol (PubChem CID 101132775) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (1R)-1-cyclohexa-1,5-dien-1-ylethanol.
| Compound Name | (1R)-1-cyclohexa-1,5-dien-1-ylethanol |
|---|---|
| PubChem CID | 101132775 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (1R)-1-cyclohexa-1,5-dien-1-ylethanol |
| SMILES | C[C@@H](O)C1=CCCC=C1 |
| InChI | InChI=1S/C8H12O/c1-7(9)8-5-3-2-4-6-8/h3,5-7,9H,2,4H2,1H3/t7-/m1/s1 |
| InChIKey | FSACPDJZYVSLNA-SSDOTTSWSA-N |
| XLogP | 1.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |