C16H22 — CID 173281402
2-(1-cyclohexa-1,5-dien-1-ylbutyl)cyclohexa-1,3-diene (PubChem CID 173281402) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-(1-cyclohexa-1,5-dien-1-ylbutyl)cyclohexa-1,3-diene.
| Compound Name | 2-(1-cyclohexa-1,5-dien-1-ylbutyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 173281402 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-(1-cyclohexa-1,5-dien-1-ylbutyl)cyclohexa-1,3-diene |
| SMILES | CCCC(C1=CCCC=C1)C1=CCCC=C1 |
| InChI | InChI=1S/C16H22/c1-2-9-16(14-10-5-3-6-11-14)15-12-7-4-8-13-15/h5,7,10-13,16H,2-4,6,8-9H2,1H3 |
| InChIKey | UNZJATHZEYAIDR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |