C9H15N — CID 145106210
(1R)-1-cyclohexa-1,5-dien-1-yl-N-methylethanamine (PubChem CID 145106210) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (1R)-1-cyclohexa-1,5-dien-1-yl-N-methylethanamine.
| Compound Name | (1R)-1-cyclohexa-1,5-dien-1-yl-N-methylethanamine |
|---|---|
| PubChem CID | 145106210 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (1R)-1-cyclohexa-1,5-dien-1-yl-N-methylethanamine |
| SMILES | CN[C@H](C)C1=CCCC=C1 |
| InChI | InChI=1S/C9H15N/c1-8(10-2)9-6-4-3-5-7-9/h4,6-8,10H,3,5H2,1-2H3/t8-/m1/s1 |
| InChIKey | VWWVXYJIOZMMJE-MRVPVSSYSA-N |
| XLogP | 1.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |