C12H16 — CID 145269063
2-[(3Z)-hexa-3,5-dien-2-yl]cyclohexa-1,3-diene (PubChem CID 145269063) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 2-[(3Z)-hexa-3,5-dien-2-yl]cyclohexa-1,3-diene.
| Compound Name | 2-[(3Z)-hexa-3,5-dien-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145269063 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 2-[(3Z)-hexa-3,5-dien-2-yl]cyclohexa-1,3-diene |
| SMILES | C=C/C=C\C(C)C1=CCCC=C1 |
| InChI | InChI=1S/C12H16/c1-3-4-8-11(2)12-9-6-5-7-10-12/h3-4,6,8-11H,1,5,7H2,2H3/b8-4- |
| InChIKey | JOELOVYKIYSSID-YWEYNIOJSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|