C14H16 — CID 142158229
2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]cyclohexa-1,3-diene (PubChem CID 142158229) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]cyclohexa-1,3-diene.
| Compound Name | 2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142158229 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]cyclohexa-1,3-diene |
| SMILES | C=C/C=C\C(=C/C=C)C1=CCCC=C1 |
| InChI | InChI=1S/C14H16/c1-3-5-10-13(9-4-2)14-11-7-6-8-12-14/h3-5,7,9-12H,1-2,6,8H2/b10-5-,13-9+ |
| InChIKey | VYKJADMENUXWJU-GXCNYSEGSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|