C12H18O — CID 164543952
methanol;2-(3-methylbuta-1,3-dien-2-yl)cyclohexa-1,3-diene (PubChem CID 164543952) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is methanol;2-(3-methylbuta-1,3-dien-2-yl)cyclohexa-1,3-diene.
| Compound Name | methanol;2-(3-methylbuta-1,3-dien-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 164543952 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | methanol;2-(3-methylbuta-1,3-dien-2-yl)cyclohexa-1,3-diene |
| SMILES | C=C(C)C(=C)C1=CCCC=C1.CO |
| InChI | InChI=1S/C11H14.CH4O/c1-9(2)10(3)11-7-5-4-6-8-11;1-2/h5,7-8H,1,3-4,6H2,2H3;2H,1H3 |
| InChIKey | HTRPSSXESIAZMW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|