C14H15N — CID 142890408
1-cyclohexa-1,5-dien-1-yl-N-methyl-1-phenylmethanimine (PubChem CID 142890408) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-N-methyl-1-phenylmethanimine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-N-methyl-1-phenylmethanimine |
|---|---|
| PubChem CID | 142890408 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-N-methyl-1-phenylmethanimine |
| SMILES | C/N=C(/C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C14H15N/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2,4-6,8-11H,3,7H2,1H3/b15-14+ |
| InChIKey | VSFGLSUZOFGXFH-CCEZHUSRSA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|