C16H12N2 — CID 143467248
2-[cyclohexa-1,5-dien-1-yl(phenyl)methylidene]propanedinitrile (PubChem CID 143467248) has the molecular formula C16H12N2 and a molecular weight of 232.29 g/mol. Its IUPAC name is 2-[cyclohexa-1,5-dien-1-yl(phenyl)methylidene]propanedinitrile.
| Compound Name | 2-[cyclohexa-1,5-dien-1-yl(phenyl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 143467248 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-[cyclohexa-1,5-dien-1-yl(phenyl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C16H12N2/c17-11-15(12-18)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1,3-5,7-10H,2,6H2 |
| InChIKey | KRPSCNDDYQLGLK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|