C16H17N — CID 144995252
(1Z)-1-cyclohexa-1,5-dien-1-yl-3-phenylbuta-1,3-dien-1-amine (PubChem CID 144995252) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is (1Z)-1-cyclohexa-1,5-dien-1-yl-3-phenylbuta-1,3-dien-1-amine.
| Compound Name | (1Z)-1-cyclohexa-1,5-dien-1-yl-3-phenylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144995252 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (1Z)-1-cyclohexa-1,5-dien-1-yl-3-phenylbuta-1,3-dien-1-amine |
| SMILES | C=C(/C=C(\N)C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C16H17N/c1-13(14-8-4-2-5-9-14)12-16(17)15-10-6-3-7-11-15/h2,4-6,8-12H,1,3,7,17H2/b16-12- |
| InChIKey | RMSDUQNRXBTIBS-VBKFSLOCSA-N |
| XLogP | 3.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|