About 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate
1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate (PubChem CID 167309998) has the molecular formula C15H14O3S
and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 167309998 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate |
| SMILES | C=C(OSOC(=O)C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C15H14O3S/c1-12(13-8-4-2-5-9-13)17-19-18-15(16)14-10-6-3-7-11-14/h2,4-6,8-11H,1,3,7H2 |
| InChIKey | CBEZGJNVHKCFIQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate (CID 167309998) is 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate is C=C(OSOC(=O)C1=CCCC=C1)c1ccccc1.
What is the InChIKey of 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate?
The InChIKey is CBEZGJNVHKCFIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3S/c1-12(13-8-4-2-5-9-13)17-19-18-15(16)14-10-6-3-7-11-14/h2,4-6,8-11H,1,3,7H2.
What are the key properties of 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate?
1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate has a molecular weight of 274.34 g/mol, XLogP of 4.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethenoxysulfanyl cyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 167309998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).