C21H16O — CID 126606855
anthracen-2-yl(cyclohexa-1,5-dien-1-yl)methanone (PubChem CID 126606855) has the molecular formula C21H16O and a molecular weight of 284.36 g/mol. Its IUPAC name is anthracen-2-yl(cyclohexa-1,5-dien-1-yl)methanone.
| Compound Name | anthracen-2-yl(cyclohexa-1,5-dien-1-yl)methanone |
|---|---|
| PubChem CID | 126606855 |
| Molecular Formula | C21H16O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | anthracen-2-yl(cyclohexa-1,5-dien-1-yl)methanone |
| SMILES | O=C(C1=CCCC=C1)c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C21H16O/c22-21(15-6-2-1-3-7-15)19-11-10-18-12-16-8-4-5-9-17(16)13-20(18)14-19/h2,4-14H,1,3H2 |
| InChIKey | RWHMHKFKFHUXCI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|