C19H32O — CID 144664025
di(cyclohexa-1,5-dien-1-yl)methanone;ethane (PubChem CID 144664025) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is di(cyclohexa-1,5-dien-1-yl)methanone;ethane.
| Compound Name | di(cyclohexa-1,5-dien-1-yl)methanone;ethane |
|---|---|
| PubChem CID | 144664025 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | di(cyclohexa-1,5-dien-1-yl)methanone;ethane |
| SMILES | CC.CC.CC.O=C(C1=CCCC=C1)C1=CCCC=C1 |
| InChI | InChI=1S/C13H14O.3C2H6/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;3*1-2/h3,5,7-10H,1-2,4,6H2;3*1-2H3 |
| InChIKey | GBUNKSXAEGFNQM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |