C14H14OY-2 — CID 176944216
carbanide;cyclohexa-1,5-dien-1-yl(phenyl)methanone;yttrium (PubChem CID 176944216) has the molecular formula C14H14OY-2 and a molecular weight of 287.17 g/mol. Its IUPAC name is carbanide;cyclohexa-1,5-dien-1-yl(phenyl)methanone;yttrium.
| Compound Name | carbanide;cyclohexa-1,5-dien-1-yl(phenyl)methanone;yttrium |
|---|---|
| PubChem CID | 176944216 |
| Molecular Formula | C14H14OY-2 |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | carbanide;cyclohexa-1,5-dien-1-yl(phenyl)methanone;yttrium |
| SMILES | O=C(C1=CCCC=C1)c1cc[c-]cc1.[CH3-].[Y] |
| InChI | InChI=1S/C13H11O.CH3.Y/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h3,5-10H,1,4H2;1H3;/q2*-1; |
| InChIKey | RCSZEOKDSSBSNB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|