C12H8IOZn- — CID 163940831
1λ3-iodacyclohexa-1,3,5-trien-4-yl(phenyl)methanone;zinc (PubChem CID 163940831) has the molecular formula C12H8IOZn- and a molecular weight of 360.49 g/mol. Its IUPAC name is 1λ3-iodacyclohexa-1,3,5-trien-4-yl(phenyl)methanone;zinc.
| Compound Name | 1λ3-iodacyclohexa-1,3,5-trien-4-yl(phenyl)methanone;zinc |
|---|---|
| PubChem CID | 163940831 |
| Molecular Formula | C12H8IOZn- |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 358.89 |
| IUPAC Name | 1λ3-iodacyclohexa-1,3,5-trien-4-yl(phenyl)methanone;zinc |
| SMILES | O=C(C1=CC=IC=C1)c1cc[c-]cc1.[Zn] |
| InChI | InChI=1S/C12H8IO.Zn/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11;/h2-9H;/q-1; |
| InChIKey | NKISVQUMZAILCK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|