About 1-phenylethanone;tungsten
1-phenylethanone;tungsten (PubChem CID 58914497) has the molecular formula C8H7OW-
and a molecular weight of 302.98 g/mol. Its IUPAC name is 1-phenylethanone;tungsten.
Molecular Properties
| Compound Name | 1-phenylethanone;tungsten |
| PubChem CID | 58914497 |
| Molecular Formula | C8H7OW- |
| Molecular Weight | 302.98 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 1-phenylethanone;tungsten |
| SMILES | CC(=O)c1cc[c-]cc1.[W] |
| InChI | InChI=1S/C8H7O.W/c1-7(9)8-5-3-2-4-6-8;/h3-6H,1H3;/q-1; |
| InChIKey | SWGXALXKRKCAIH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.98 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethanone;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanone;tungsten?
The IUPAC name of 1-phenylethanone;tungsten (CID 58914497) is 1-phenylethanone;tungsten.
What is the SMILES notation for 1-phenylethanone;tungsten?
The canonical SMILES for 1-phenylethanone;tungsten is CC(=O)c1cc[c-]cc1.[W].
What is the InChIKey of 1-phenylethanone;tungsten?
The InChIKey is SWGXALXKRKCAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7O.W/c1-7(9)8-5-3-2-4-6-8;/h3-6H,1H3;/q-1;.
What are the key properties of 1-phenylethanone;tungsten?
1-phenylethanone;tungsten has a molecular weight of 302.98 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanone;tungsten is sourced from PubChem (CID 58914497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).