C16H15N — CID 145403765
(Z)-3-cyclohexa-1,5-dien-1-yl-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 145403765) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is (Z)-3-cyclohexa-1,5-dien-1-yl-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-cyclohexa-1,5-dien-1-yl-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 145403765 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (Z)-3-cyclohexa-1,5-dien-1-yl-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C(C#N)=C/C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C16H15N/c1-13-7-9-15(10-8-13)16(12-17)11-14-5-3-2-4-6-14/h3,5-11H,2,4H2,1H3/b16-11+ |
| InChIKey | HPVZCRMBTPOGTA-LFIBNONCSA-N |
| XLogP | 4.18 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|