C23H26N+ — CID 145403764
(Z)-3-cyclohexa-1,5-dien-1-yl-2-(4-methylphenyl)prop-2-enenitrile;2-methyl-3-methylidenepent-1-ene (PubChem CID 145403764) has the molecular formula C23H26N+ and a molecular weight of 316.47 g/mol. Its IUPAC name is (Z)-3-cyclohexa-1,5-dien-1-yl-2-(4-methylphenyl)prop-2-enenitrile;2-methyl-3-methylidenepent-1-ene.
| Compound Name | (Z)-3-cyclohexa-1,5-dien-1-yl-2-(4-methylphenyl)prop-2-enenitrile;2-methyl-3-methylidenepent-1-ene |
|---|---|
| PubChem CID | 145403764 |
| Molecular Formula | C23H26N+ |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (Z)-3-cyclohexa-1,5-dien-1-yl-2-(4-methylphenyl)prop-2-enenitrile;2-methyl-3-methylidenepent-1-ene |
| SMILES | C=C(C)C(=C)[CH+]C.Cc1ccc(/C(C#N)=C/C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C16H15N.C7H11/c1-13-7-9-15(10-8-13)16(12-17)11-14-5-3-2-4-6-14;1-5-7(4)6(2)3/h3,5-11H,2,4H2,1H3;5H,2,4H2,1,3H3/q;+1/b16-11+; |
| InChIKey | ZZGNIPNFXBFWSK-YFMOEUEHSA-N |
| XLogP | 6.52 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|