About cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene
cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene (PubChem CID 177043562) has the molecular formula C16H26
and a molecular weight of 218.38 g/mol. Its IUPAC name is cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene.
Molecular Properties
| Compound Name | cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene |
| PubChem CID | 177043562 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene |
| SMILES | C1CCC1.C=C(C)c1ccc(C)cc1.CC |
| InChI | InChI=1S/C10H12.C4H8.C2H6/c1-8(2)10-6-4-9(3)5-7-10;1-2-4-3-1;1-2/h4-7H,1H2,2-3H3;1-4H2;1-2H3 |
| InChIKey | AAIHSZJYXWKXGU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene?
The IUPAC name of cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene (CID 177043562) is cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene.
What is the SMILES notation for cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene?
The canonical SMILES for cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene is C1CCC1.C=C(C)c1ccc(C)cc1.CC.
What is the InChIKey of cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene?
The InChIKey is AAIHSZJYXWKXGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C4H8.C2H6/c1-8(2)10-6-4-9(3)5-7-10;1-2-4-3-1;1-2/h4-7H,1H2,2-3H3;1-4H2;1-2H3.
What are the key properties of cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene?
cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene has a molecular weight of 218.38 g/mol, XLogP of 5.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;ethane;1-methyl-4-prop-1-en-2-ylbenzene is sourced from PubChem (CID 177043562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).