C33H38N4O2S2 — CID 143240761
3-N'-(benzenecarbonothioyl)-1-N'-(cyclohexa-1,5-diene-1-carbothioyl)-1-N',3-N'-diphenylpropanedihydrazide;ethane (PubChem CID 143240761) has the molecular formula C33H38N4O2S2 and a molecular weight of 586.83 g/mol. Its IUPAC name is 3-N'-(benzenecarbonothioyl)-1-N'-(cyclohexa-1,5-diene-1-carbothioyl)-1-N',3-N'-diphenylpropanedihydrazide;ethane.
| Compound Name | 3-N'-(benzenecarbonothioyl)-1-N'-(cyclohexa-1,5-diene-1-carbothioyl)-1-N',3-N'-diphenylpropanedihydrazide;ethane |
|---|---|
| PubChem CID | 143240761 |
| Molecular Formula | C33H38N4O2S2 |
| Molecular Weight | 586.83 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | 3-N'-(benzenecarbonothioyl)-1-N'-(cyclohexa-1,5-diene-1-carbothioyl)-1-N',3-N'-diphenylpropanedihydrazide;ethane |
| SMILES | CC.CC.O=C(CC(=O)NN(C(=S)c1ccccc1)c1ccccc1)NN(C(=S)C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C29H26N4O2S2.2C2H6/c34-26(30-32(24-17-9-3-10-18-24)28(36)22-13-5-1-6-14-22)21-27(35)31-33(25-19-11-4-12-20-25)29(37)23-15-7-2-8-16-23;2*1-2/h1,3-7,9-20H,2,8,21H2,(H,30,34)(H,31,35);2*1-2H3 |
| InChIKey | PZEGBNZLYXROPB-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.83 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|