C24H32N4O2S2 — CID 143634366
1-N',3-N'-bis(benzenecarbonothioyl)-1-N',3-N'-diethyl-2-methylpropanedihydrazide;ethane (PubChem CID 143634366) has the molecular formula C24H32N4O2S2 and a molecular weight of 472.68 g/mol. Its IUPAC name is 1-N',3-N'-bis(benzenecarbonothioyl)-1-N',3-N'-diethyl-2-methylpropanedihydrazide;ethane.
| Compound Name | 1-N',3-N'-bis(benzenecarbonothioyl)-1-N',3-N'-diethyl-2-methylpropanedihydrazide;ethane |
|---|---|
| PubChem CID | 143634366 |
| Molecular Formula | C24H32N4O2S2 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 1-N',3-N'-bis(benzenecarbonothioyl)-1-N',3-N'-diethyl-2-methylpropanedihydrazide;ethane |
| SMILES | CC.CCN(NC(=O)C(C)C(=O)NN(CC)C(=S)c1ccccc1)C(=S)c1ccccc1 |
| InChI | InChI=1S/C22H26N4O2S2.C2H6/c1-4-25(21(29)17-12-8-6-9-13-17)23-19(27)16(3)20(28)24-26(5-2)22(30)18-14-10-7-11-15-18;1-2/h6-16H,4-5H2,1-3H3,(H,23,27)(H,24,28);1-2H3 |
| InChIKey | JVAVNPZAAKFHBJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|