C29H36N4O2S2 — CID 10230476
1-N',3-N'-bis(cyclohexanecarbothioyl)-1-N',3-N'-diphenylpropanedihydrazide (PubChem CID 10230476) has the molecular formula C29H36N4O2S2 and a molecular weight of 536.77 g/mol. Its IUPAC name is 1-N',3-N'-bis(cyclohexanecarbothioyl)-1-N',3-N'-diphenylpropanedihydrazide.
| Compound Name | 1-N',3-N'-bis(cyclohexanecarbothioyl)-1-N',3-N'-diphenylpropanedihydrazide |
|---|---|
| PubChem CID | 10230476 |
| Molecular Formula | C29H36N4O2S2 |
| Molecular Weight | 536.77 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 1-N',3-N'-bis(cyclohexanecarbothioyl)-1-N',3-N'-diphenylpropanedihydrazide |
| SMILES | O=C(CC(=O)NN(C(=S)C1CCCCC1)c1ccccc1)NN(C(=S)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C29H36N4O2S2/c34-26(30-32(24-17-9-3-10-18-24)28(36)22-13-5-1-6-14-22)21-27(35)31-33(25-19-11-4-12-20-25)29(37)23-15-7-2-8-16-23/h3-4,9-12,17-20,22-23H,1-2,5-8,13-16,21H2,(H,30,34)(H,31,35) |
| InChIKey | OJLYIOHRGTUYON-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.77 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|