C23H30N6O2S2 — CID 10228040
1-N',3-N'-bis[3-(dimethylamino)benzenecarbothioyl]-1-N',3-N'-dimethylpropanedihydrazide (PubChem CID 10228040) has the molecular formula C23H30N6O2S2 and a molecular weight of 486.67 g/mol. Its IUPAC name is 1-N',3-N'-bis[3-(dimethylamino)benzenecarbothioyl]-1-N',3-N'-dimethylpropanedihydrazide.
| Compound Name | 1-N',3-N'-bis[3-(dimethylamino)benzenecarbothioyl]-1-N',3-N'-dimethylpropanedihydrazide |
|---|---|
| PubChem CID | 10228040 |
| Molecular Formula | C23H30N6O2S2 |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 1-N',3-N'-bis[3-(dimethylamino)benzenecarbothioyl]-1-N',3-N'-dimethylpropanedihydrazide |
| SMILES | CN(NC(=O)CC(=O)NN(C)C(=S)c1cccc(N(C)C)c1)C(=S)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C23H30N6O2S2/c1-26(2)18-11-7-9-16(13-18)22(32)28(5)24-20(30)15-21(31)25-29(6)23(33)17-10-8-12-19(14-17)27(3)4/h7-14H,15H2,1-6H3,(H,24,30)(H,25,31) |
| InChIKey | DXROKKJPKSDRDG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|