C19H20N4O2S2 — CID 10222637
1-N',3-N'-di(ethanethioyl)-1-N',3-N'-diphenylpropanedihydrazide (PubChem CID 10222637) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-N',3-N'-di(ethanethioyl)-1-N',3-N'-diphenylpropanedihydrazide.
| Compound Name | 1-N',3-N'-di(ethanethioyl)-1-N',3-N'-diphenylpropanedihydrazide |
|---|---|
| PubChem CID | 10222637 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 1-N',3-N'-di(ethanethioyl)-1-N',3-N'-diphenylpropanedihydrazide |
| SMILES | CC(=S)N(NC(=O)CC(=O)NN(C(C)=S)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N4O2S2/c1-14(26)22(16-9-5-3-6-10-16)20-18(24)13-19(25)21-23(15(2)27)17-11-7-4-8-12-17/h3-12H,13H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | WRJQYIOTPRMTQA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|