C25H28N4O6S2 — CID 10165914
5-(N-[[3-[2-(4-carboxybutanethioyl)-2-phenylhydrazinyl]-3-oxopropanoyl]amino]anilino)-5-sulfanylidenepentanoic acid (PubChem CID 10165914) has the molecular formula C25H28N4O6S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is 5-(N-[[3-[2-(4-carboxybutanethioyl)-2-phenylhydrazinyl]-3-oxopropanoyl]amino]anilino)-5-sulfanylidenepentanoic acid.
| Compound Name | 5-(N-[[3-[2-(4-carboxybutanethioyl)-2-phenylhydrazinyl]-3-oxopropanoyl]amino]anilino)-5-sulfanylidenepentanoic acid |
|---|---|
| PubChem CID | 10165914 |
| Molecular Formula | C25H28N4O6S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 5-(N-[[3-[2-(4-carboxybutanethioyl)-2-phenylhydrazinyl]-3-oxopropanoyl]amino]anilino)-5-sulfanylidenepentanoic acid |
| SMILES | O=C(O)CCCC(=S)N(NC(=O)CC(=O)NN(C(=S)CCCC(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O6S2/c30-20(26-28(18-9-3-1-4-10-18)22(36)13-7-15-24(32)33)17-21(31)27-29(19-11-5-2-6-12-19)23(37)14-8-16-25(34)35/h1-6,9-12H,7-8,13-17H2,(H,26,30)(H,27,31)(H,32,33)(H,34,35) |
| InChIKey | GOIGVRQQFWCVCO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|