About N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide
N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide (PubChem CID 144816078) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide.
Molecular Properties
| Compound Name | N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide |
| PubChem CID | 144816078 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide |
| SMILES | C=N/C(=N\CC1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2/c1-16-15(14-10-6-3-7-11-14)17-12-13-8-4-2-5-9-13/h3-4,6-11H,1-2,5,12H2/b17-15- |
| InChIKey | PJGZOOKBUWNDDZ-ICFOKQHNSA-N |
| XLogP | 3.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide?
The IUPAC name of N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide (CID 144816078) is N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide.
What is the SMILES notation for N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide?
The canonical SMILES for N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide is C=N/C(=N\CC1=CCCC=C1)c1ccccc1.
What is the InChIKey of N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide?
The InChIKey is PJGZOOKBUWNDDZ-ICFOKQHNSA-N. The full InChI is InChI=1S/C15H16N2/c1-16-15(14-10-6-3-7-11-14)17-12-13-8-4-2-5-9-13/h3-4,6-11H,1-2,5,12H2/b17-15-.
What are the key properties of N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide?
N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide has a molecular weight of 224.31 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(cyclohexa-1,5-dien-1-ylmethyl)-N-methylidenebenzenecarboximidamide is sourced from PubChem (CID 144816078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).