C27H24N2 — CID 145265295
4-cyclohexa-1,5-dien-1-yl-N-methylidene-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide (PubChem CID 145265295) has the molecular formula C27H24N2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-N-methylidene-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-N-methylidene-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145265295 |
| Molecular Formula | C27H24N2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-N-methylidene-N'-[(4-phenylphenyl)methyl]benzenecarboximidamide |
| SMILES | C=N/C(=N\Cc1ccc(-c2ccccc2)cc1)c1ccc(C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C27H24N2/c1-28-27(26-18-16-25(17-19-26)23-10-6-3-7-11-23)29-20-21-12-14-24(15-13-21)22-8-4-2-5-9-22/h2,4-6,8-19H,1,3,7,20H2/b29-27- |
| InChIKey | VZGZSMKURIGSIV-OHYPFYFLSA-N |
| XLogP | 6.73 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|