C25H26N2 — CID 166096417
N'-[1-(4-cyclohexa-1,5-dien-1-ylphenyl)ethenyl]-N-(1-phenylpropylidene)ethanimidamide (PubChem CID 166096417) has the molecular formula C25H26N2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N'-[1-(4-cyclohexa-1,5-dien-1-ylphenyl)ethenyl]-N-(1-phenylpropylidene)ethanimidamide.
| Compound Name | N'-[1-(4-cyclohexa-1,5-dien-1-ylphenyl)ethenyl]-N-(1-phenylpropylidene)ethanimidamide |
|---|---|
| PubChem CID | 166096417 |
| Molecular Formula | C25H26N2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N'-[1-(4-cyclohexa-1,5-dien-1-ylphenyl)ethenyl]-N-(1-phenylpropylidene)ethanimidamide |
| SMILES | C=C(/N=C(C)/N=C(\CC)c1ccccc1)c1ccc(C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C25H26N2/c1-4-25(24-13-9-6-10-14-24)27-20(3)26-19(2)21-15-17-23(18-16-21)22-11-7-5-8-12-22/h6-7,9-18H,2,4-5,8H2,1,3H3/b26-20+,27-25+ |
| InChIKey | WZRVJTIGTYVIJS-IGWYZIOSSA-N |
| XLogP | 6.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|