C20H34 — CID 143424026
2-cyclohexa-1,5-dien-1-ylethylbenzene;ethane (PubChem CID 143424026) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-ylethylbenzene;ethane.
| Compound Name | 2-cyclohexa-1,5-dien-1-ylethylbenzene;ethane |
|---|---|
| PubChem CID | 143424026 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-ylethylbenzene;ethane |
| SMILES | C1=CC(CCc2ccccc2)=CCC1.CC.CC.CC |
| InChI | InChI=1S/C14H16.3C2H6/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;3*1-2/h1,3-5,7-10H,2,6,11-12H2;3*1-2H3 |
| InChIKey | OECGJJDRUCNWDJ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |