C21H28O — CID 143289907
7-cyclohexa-1,5-dien-1-ylhept-2-ynylbenzene;formaldehyde;methane (PubChem CID 143289907) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is 7-cyclohexa-1,5-dien-1-ylhept-2-ynylbenzene;formaldehyde;methane.
| Compound Name | 7-cyclohexa-1,5-dien-1-ylhept-2-ynylbenzene;formaldehyde;methane |
|---|---|
| PubChem CID | 143289907 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 7-cyclohexa-1,5-dien-1-ylhept-2-ynylbenzene;formaldehyde;methane |
| SMILES | C.C(#CCc1ccccc1)CCCCC1=CCCC=C1.C=O |
| InChI | InChI=1S/C19H22.CH2O.CH4/c1(2-6-12-18-14-8-4-9-15-18)3-7-13-19-16-10-5-11-17-19;1-2;/h5,8,10-11,14-17H,1-2,4,6,9,12-13H2;1H2;1H4 |
| InChIKey | CWYHLZJDJKKNNC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|