About cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen
cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen (PubChem CID 156740517) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen.
Analyze cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen (CID 156740517) is cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen is O=C(NCc1ccccc1)OCC1=CCCC=C1.[H][H].
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen?
The InChIKey is SNTXPPUDKPMBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2.H2/c17-15(16-11-13-7-3-1-4-8-13)18-12-14-9-5-2-6-10-14;/h1,3-5,7-10H,2,6,11-12H2,(H,16,17);1H.
What are the key properties of cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen?
cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen has a molecular weight of 245.32 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethyl N-benzylcarbamate;molecular hydrogen is sourced from PubChem (CID 156740517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).