C18H24N2O3 — CID 126571640
cyclohexa-1,5-dien-1-ylmethyl (2S)-2-[(2-amino-1-hydroxyethyl)amino]-3-phenylpropanoate (PubChem CID 126571640) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl (2S)-2-[(2-amino-1-hydroxyethyl)amino]-3-phenylpropanoate.
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl (2S)-2-[(2-amino-1-hydroxyethyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 126571640 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl (2S)-2-[(2-amino-1-hydroxyethyl)amino]-3-phenylpropanoate |
| SMILES | NCC(O)N[C@@H](Cc1ccccc1)C(=O)OCC1=CCCC=C1 |
| InChI | InChI=1S/C18H24N2O3/c19-12-17(21)20-16(11-14-7-3-1-4-8-14)18(22)23-13-15-9-5-2-6-10-15/h1,3-5,7-10,16-17,20-21H,2,6,11-13,19H2/t16-,17?/m0/s1 |
| InChIKey | HDMSVAKXHVJIFP-BHWOMJMDSA-N |
| XLogP | 1.28 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|