C29H36N2O2 — CID 144763142
N-benzyl-N-[3-[1-(cyclohexa-1,5-dien-1-ylmethoxy)ethenylamino]-2-methyl-4-phenylbutyl]acetamide (PubChem CID 144763142) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is N-benzyl-N-[3-[1-(cyclohexa-1,5-dien-1-ylmethoxy)ethenylamino]-2-methyl-4-phenylbutyl]acetamide.
| Compound Name | N-benzyl-N-[3-[1-(cyclohexa-1,5-dien-1-ylmethoxy)ethenylamino]-2-methyl-4-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 144763142 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | N-benzyl-N-[3-[1-(cyclohexa-1,5-dien-1-ylmethoxy)ethenylamino]-2-methyl-4-phenylbutyl]acetamide |
| SMILES | C=C(NC(Cc1ccccc1)C(C)CN(Cc1ccccc1)C(C)=O)OCC1=CCCC=C1 |
| InChI | InChI=1S/C29H36N2O2/c1-23(20-31(25(3)32)21-27-15-9-5-10-16-27)29(19-26-13-7-4-8-14-26)30-24(2)33-22-28-17-11-6-12-18-28/h4-5,7-11,13-18,23,29-30H,2,6,12,19-22H2,1,3H3 |
| InChIKey | OBJUJMKEOYOIHI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|