About cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate
cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate (PubChem CID 144572286) has the molecular formula C15H23NO5
and a molecular weight of 297.35 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate |
| PubChem CID | 144572286 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate |
| SMILES | COC[C@H](NC(=O)OC(C)C)C(=O)OCC1=CCCC=C1 |
| InChI | InChI=1S/C15H23NO5/c1-11(2)21-15(18)16-13(10-19-3)14(17)20-9-12-7-5-4-6-8-12/h5,7-8,11,13H,4,6,9-10H2,1-3H3,(H,16,18)/t13-/m0/s1 |
| InChIKey | YLVOMGXJJCDSMV-ZDUSSCGKSA-N |
| XLogP | 1.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate (CID 144572286) is cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate is COC[C@H](NC(=O)OC(C)C)C(=O)OCC1=CCCC=C1.
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate?
The InChIKey is YLVOMGXJJCDSMV-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H23NO5/c1-11(2)21-15(18)16-13(10-19-3)14(17)20-9-12-7-5-4-6-8-12/h5,7-8,11,13H,4,6,9-10H2,1-3H3,(H,16,18)/t13-/m0/s1.
What are the key properties of cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate?
cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate has a molecular weight of 297.35 g/mol, XLogP of 1.96, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethyl (2S)-3-methoxy-2-(propan-2-yloxycarbonylamino)propanoate is sourced from PubChem (CID 144572286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).