C11H17NO2 — CID 172578392
cyclohepta-1,6-dien-1-ylmethyl (2S)-2-aminopropanoate (PubChem CID 172578392) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is cyclohepta-1,6-dien-1-ylmethyl (2S)-2-aminopropanoate.
| Compound Name | cyclohepta-1,6-dien-1-ylmethyl (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 172578392 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | cyclohepta-1,6-dien-1-ylmethyl (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)OCC1=CCCCC=C1 |
| InChI | InChI=1S/C11H17NO2/c1-9(12)11(13)14-8-10-6-4-2-3-5-7-10/h4,6-7,9H,2-3,5,8,12H2,1H3/t9-/m0/s1 |
| InChIKey | JPAAVSYURLJFQG-VIFPVBQESA-N |
| XLogP | 1.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |