About 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide
2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide (PubChem CID 155283352) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide.
Molecular Properties
| Compound Name | 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide |
| PubChem CID | 155283352 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide |
| SMILES | NC(=O)C(N)CC1=CCCC=C1 |
| InChI | InChI=1S/C9H14N2O/c10-8(9(11)12)6-7-4-2-1-3-5-7/h2,4-5,8H,1,3,6,10H2,(H2,11,12) |
| InChIKey | TWMFYRJKUSFAPJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide?
The IUPAC name of 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide (CID 155283352) is 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide.
What is the SMILES notation for 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide?
The canonical SMILES for 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide is NC(=O)C(N)CC1=CCCC=C1.
What is the InChIKey of 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide?
The InChIKey is TWMFYRJKUSFAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c10-8(9(11)12)6-7-4-2-1-3-5-7/h2,4-5,8H,1,3,6,10H2,(H2,11,12).
What are the key properties of 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide?
2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide has a molecular weight of 166.22 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-cyclohexa-1,5-dien-1-ylpropanamide is sourced from PubChem (CID 155283352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).