C13H17NO3 — CID 142850854
cyclohexa-1,5-dien-1-ylmethyl 2-formylpyrrolidine-1-carboxylate (PubChem CID 142850854) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl 2-formylpyrrolidine-1-carboxylate.
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl 2-formylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142850854 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl 2-formylpyrrolidine-1-carboxylate |
| SMILES | O=CC1CCCN1C(=O)OCC1=CCCC=C1 |
| InChI | InChI=1S/C13H17NO3/c15-9-12-7-4-8-14(12)13(16)17-10-11-5-2-1-3-6-11/h2,5-6,9,12H,1,3-4,7-8,10H2 |
| InChIKey | MBOUDQWYEGAPAA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|