About cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate
cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate (PubChem CID 143395298) has the molecular formula C13H17N5O2
and a molecular weight of 275.31 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate |
| PubChem CID | 143395298 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCC1=CCCC=C1)N1CCC[C@H]1c1nn[nH]n1 |
| InChI | InChI=1S/C13H17N5O2/c19-13(20-9-10-5-2-1-3-6-10)18-8-4-7-11(18)12-14-16-17-15-12/h2,5-6,11H,1,3-4,7-9H2,(H,14,15,16,17)/t11-/m0/s1 |
| InChIKey | ANEMWTQKGAZPKU-NSHDSACASA-N |
| XLogP | 1.75 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate (CID 143395298) is cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate is O=C(OCC1=CCCC=C1)N1CCC[C@H]1c1nn[nH]n1.
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate?
The InChIKey is ANEMWTQKGAZPKU-NSHDSACASA-N. The full InChI is InChI=1S/C13H17N5O2/c19-13(20-9-10-5-2-1-3-6-10)18-8-4-7-11(18)12-14-16-17-15-12/h2,5-6,11H,1,3-4,7-9H2,(H,14,15,16,17)/t11-/m0/s1.
What are the key properties of cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate?
cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate has a molecular weight of 275.31 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethyl (2S)-2-(2H-tetrazol-5-yl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 143395298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).