About cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate
cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate (PubChem CID 145375430) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate.
Analyze cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate (CID 145375430) is cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate is CC1CCC(C(=O)OCC2=CCCC=C2)NC1.
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate?
The InChIKey is BOHNESNRZSTVNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-11-7-8-13(15-9-11)14(16)17-10-12-5-3-2-4-6-12/h3,5-6,11,13,15H,2,4,7-10H2,1H3.
What are the key properties of cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate?
cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate has a molecular weight of 235.33 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethyl 5-methylpiperidine-2-carboxylate is sourced from PubChem (CID 145375430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).