C12H17NO4 — CID 163245221
cyclohexa-1,5-dien-1-ylmethyl acetate;1,3-oxazolidin-2-one (PubChem CID 163245221) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl acetate;1,3-oxazolidin-2-one.
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl acetate;1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 163245221 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl acetate;1,3-oxazolidin-2-one |
| SMILES | CC(=O)OCC1=CCCC=C1.O=C1NCCO1 |
| InChI | InChI=1S/C9H12O2.C3H5NO2/c1-8(10)11-7-9-5-3-2-4-6-9;5-3-4-1-2-6-3/h3,5-6H,2,4,7H2,1H3;1-2H2,(H,4,5) |
| InChIKey | PZROGTWNPHNPCM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |