C8H16N2O4S — CID 69357157
(2S)-2-amino-4-methylsulfanylbutanoic acid;1,3-oxazolidin-2-one (PubChem CID 69357157) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;1,3-oxazolidin-2-one.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69357157 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;1,3-oxazolidin-2-one |
| SMILES | CSCC[C@H](N)C(=O)O.O=C1NCCO1 |
| InChI | InChI=1S/C5H11NO2S.C3H5NO2/c1-9-3-2-4(6)5(7)8;5-3-4-1-2-6-3/h4H,2-3,6H2,1H3,(H,7,8);1-2H2,(H,4,5)/t4-;/m0./s1 |
| InChIKey | SEGUYRHCOJHERZ-WCCKRBBISA-N |
| XLogP | -0.12 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |