C9H17N3O4S — CID 67023954
(2S)-2-amino-4-methylsulfanylbutanoic acid;piperazine-2,3-dione (PubChem CID 67023954) has the molecular formula C9H17N3O4S and a molecular weight of 263.32 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;piperazine-2,3-dione.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;piperazine-2,3-dione |
|---|---|
| PubChem CID | 67023954 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;piperazine-2,3-dione |
| SMILES | CSCC[C@H](N)C(=O)O.O=C1NCCNC1=O |
| InChI | InChI=1S/C5H11NO2S.C4H6N2O2/c1-9-3-2-4(6)5(7)8;7-3-4(8)6-2-1-5-3/h4H,2-3,6H2,1H3,(H,7,8);1-2H2,(H,5,7)(H,6,8)/t4-;/m0./s1 |
| InChIKey | YUCVQGFAFQWGFK-WCCKRBBISA-N |
| XLogP | -1.62 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|