C8H15N3O5 — CID 67413612
2-amino-4-hydroxybutanoic acid;piperazine-2,3-dione (PubChem CID 67413612) has the molecular formula C8H15N3O5 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2-amino-4-hydroxybutanoic acid;piperazine-2,3-dione.
| Compound Name | 2-amino-4-hydroxybutanoic acid;piperazine-2,3-dione |
|---|---|
| PubChem CID | 67413612 |
| Molecular Formula | C8H15N3O5 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-amino-4-hydroxybutanoic acid;piperazine-2,3-dione |
| SMILES | NC(CCO)C(=O)O.O=C1NCCNC1=O |
| InChI | InChI=1S/C4H6N2O2.C4H9NO3/c7-3-4(8)6-2-1-5-3;5-3(1-2-6)4(7)8/h1-2H2,(H,5,7)(H,6,8);3,6H,1-2,5H2,(H,7,8) |
| InChIKey | KARCXTADNKQCBE-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|