C10H21N5O3 — CID 70013185
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;pyrrolidin-2-one (PubChem CID 70013185) has the molecular formula C10H21N5O3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;pyrrolidin-2-one.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;pyrrolidin-2-one |
|---|---|
| PubChem CID | 70013185 |
| Molecular Formula | C10H21N5O3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;pyrrolidin-2-one |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.O=C1CCCN1 |
| InChI | InChI=1S/C6H14N4O2.C4H7NO/c7-4(5(11)12)2-1-3-10-6(8)9;6-4-2-1-3-5-4/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1-3H2,(H,5,6)/t4-;/m0./s1 |
| InChIKey | URDCSGIJHAGUTA-WCCKRBBISA-N |
| XLogP | -1.65 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|